3-(DIFLUOROMETHOXY)NITROBENZENE
Catalog No: FT-0653538
CAS No: 22236-07-3
- Chemical Name: 3-(DIFLUOROMETHOXY)NITROBENZENE
- Molecular Formula: C7H5F2NO3
- Molecular Weight: 189.12
- InChI Key: NYVCZALWNPMMSQ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5F2NO3/c8-7(9)13-6-3-1-2-5(4-6)10(11)12/h1-4,7H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 22236-07-3 |
| Flash_Point: | 105.3±24.6 °C |
| Product_Name: | 3-(Difluoromethoxy)nitrobenzene |
| Bolling_Point: | 250.6±30.0 °C at 760 mmHg |
| FW: | 189.116 |
| Melting_Point: | N/A |
| MF: | C7H5F2NO3 |
| Density: | 1.4±0.1 g/cm3 |
| Refractive_Index: | 1.494 |
|---|---|
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Flash_Point: | 105.3±24.6 °C |
| LogP: | 2.35 |
| Bolling_Point: | 250.6±30.0 °C at 760 mmHg |
| FW: | 189.116 |
| PSA: | 55.05000 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :5 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :N/A ', '6. TPSA 55 ', '7. Heavy Atom Count :13 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :183 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| MF: | C7H5F2NO3 |
| Exact_Mass: | 189.023743 |
| Molecular_Structure: | ['1 . Molar refractive index 3976 ', '2 . Molar volume (cm3/mol)1365 ', '3 . Parachor (902K)3358 ', '4 表面张力(dyne/cm)365 ', '5 . Polarizability (10-24cm3)1576'] |
| Density: | 1.4±0.1 g/cm3 |
| More_Info: | ['1. Appearance 灰Yellow Liquid ,有特征性气味 ', '2. Density(g/mL,25/4℃)1391 ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)Unknow ', '5. Boiling point(ºC,Atmospheric pressure)240-242 ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexUnknow ', '8. Flash point(ºC) >110 ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 36/37/38 |
| HS_Code: | 2909309090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |